CAS 1360946-84-4 appears in our catalog under these names: 5'-Methylspiro[cyclopropane-1,3'-indolin]-2'-one, 95%, 5'-Methylspiro(cyclopropane-1,3'-indolin)-2'-one, 95%, 5'–METHYLSPIRO(CYCLOPROPANE–1,3'–INDOLIN)–2'–ONE. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 250mg, 1g.
5-methylspiro[1H-indole-3,1'-cyclopropane]-2-one (CAS 1360946-84-4) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 5-methylspiro[1H-indole-3,1'-cyclopropane]-2-one. InChIKey: XNYIJZZCFVTAIB-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 5-methylspiro[1H-indole-3,1'-cyclopropane]-2-one |
| InChIKey | XNYIJZZCFVTAIB-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC(=O)C23CC3 |
Computed by PubChem (NCBI)