CAS 136098-02-7 is the registry number for Heparin disaccharide II-H disodium salt. Offered by: Biosynth. Available pack sizes: 2mg, 1mg, 5mg, 10mg.
CAS 136098-02-7 identifies a chemical compound with the molecular formula C12H19NNaO13S and a molecular weight of 440.34 g/mol. InChIKey: PZZOMOYPUZNPJJ-UHFFFAOYSA-N.
| Molecular formula | C12H19NNaO13S |
|---|---|
| Molecular weight | 440.34 g/mol |
| InChIKey | PZZOMOYPUZNPJJ-UHFFFAOYSA-N |
| SMILES | C1=C(OC(C(C1O)O)OC(C(COS(=O)(=O)O)O)C(C(C=O)N)O)C(=O)O.[Na] |
Computed by PubChem (NCBI)