Products 1361003-61-3
CAS 1361003-61-3 appears in our catalog under these names: 2-(1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl)ethan-1-amine, 95%, 2-(1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl)ethan-1-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]ethanamine (CAS 1361003-61-3) is a chemical compound with the molecular formula C7H10F3N3 and a molecular weight of 193.17 g/mol. IUPAC name: 2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]ethanamine. InChIKey: MFFCIYIOVLQLDY-UHFFFAOYSA-N.
| Molecular formula | C7H10F3N3 |
|---|---|
| Molecular weight | 193.17 g/mol |
| IUPAC name | 2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]ethanamine |
| InChIKey | MFFCIYIOVLQLDY-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C(F)(F)F)CCN |
Computed by PubChem (NCBI)