CAS 1361110-63-5 appears in our catalog under these names: 3-Chloro-4-morpholinophenylboronic Acid Pinacol Ester 95%, 3-Chloro-4-morpholinophenylboronic Acid Pinacol Ester, 95%, 95%, 4-(2-Chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)morpholine, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-[2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholine (CAS 1361110-63-5) is a chemical compound with the molecular formula C16H23BClNO3 and a molecular weight of 323.6 g/mol. IUPAC name: 4-[2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholine. InChIKey: SKJAWVMUHVUHMM-UHFFFAOYSA-N.
| Molecular formula | C16H23BClNO3 |
|---|---|
| Molecular weight | 323.6 g/mol |
| IUPAC name | 4-[2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholine |
| InChIKey | SKJAWVMUHVUHMM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)N3CCOCC3)Cl |
Computed by PubChem (NCBI)