CAS 1361112-26-6 appears in our catalog under these names: 4-(4-(tert-Butoxycarbonyl)piperazin-2-yl)benzoic acid, 97%, 4-{4-((tert-Butoxy)carbonyl)piperazin-2-yl}benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-2-yl]benzoic acid (CAS 1361112-26-6) is a chemical compound with the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. IUPAC name: 4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-2-yl]benzoic acid. InChIKey: NOFZILQIQHEJAT-UHFFFAOYSA-N.
| Molecular formula | C16H22N2O4 |
|---|---|
| Molecular weight | 306.36 g/mol |
| IUPAC name | 4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-2-yl]benzoic acid |
| InChIKey | NOFZILQIQHEJAT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC(C1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)