Products 1361113-69-0

CAS 1361113-69-0 is the registry number for 1-Acetyl-3-(3-pyridin-3-ylpropyl)piperidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

1-acetyl-3-(3-pyridin-3-ylpropyl)piperidine-3-carboxylic acid (CAS 1361113-69-0) is a chemical compound with the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. IUPAC name: 1-acetyl-3-(3-pyridin-3-ylpropyl)piperidine-3-carboxylic acid. InChIKey: LXCJDHDMHDBZCG-UHFFFAOYSA-N.

Identity
Molecular formulaC16H22N2O3
Molecular weight290.36 g/mol
IUPAC name1-acetyl-3-(3-pyridin-3-ylpropyl)piperidine-3-carboxylic acid
InChIKeyLXCJDHDMHDBZCG-UHFFFAOYSA-N
SMILESCC(=O)N1CCCC(C1)(CCCC2=CN=CC=C2)C(=O)O

Computed by PubChem (NCBI)