Products 1361198-52-8

CAS 1361198-52-8 is the registry number for 1,1-Dimethylethyl 2,6-dimethyl-4-(phenylmethoxy)benzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 2,6-dimethyl-4-phenylmethoxybenzoate (CAS 1361198-52-8) is a chemical compound with the molecular formula C20H24O3 and a molecular weight of 312.4 g/mol. IUPAC name: tert-butyl 2,6-dimethyl-4-phenylmethoxybenzoate. InChIKey: BEUFGPCZGWZSQP-UHFFFAOYSA-N.

Identity
Molecular formulaC20H24O3
Molecular weight312.4 g/mol
IUPAC nametert-butyl 2,6-dimethyl-4-phenylmethoxybenzoate
InChIKeyBEUFGPCZGWZSQP-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1C(=O)OC(C)(C)C)C)OCC2=CC=CC=C2

Computed by PubChem (NCBI)