CAS 13617-40-8 appears in our catalog under these names: Trichloro(3-phenylpropyl)silane, 95%, Trichloro(3–phenylpropyl)silane. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 25g, 1g.
Trichloro(3-phenylpropyl)silane (CAS 13617-40-8) is a chemical compound with the molecular formula C9H11Cl3Si and a molecular weight of 253.6 g/mol. IUPAC name: trichloro(3-phenylpropyl)silane. InChIKey: QJOHXSVBLYVERP-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl3Si |
|---|---|
| Molecular weight | 253.6 g/mol |
| IUPAC name | trichloro(3-phenylpropyl)silane |
| InChIKey | QJOHXSVBLYVERP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC[Si](Cl)(Cl)Cl |
Computed by PubChem (NCBI)