CAS 136191-16-7 appears in our catalog under these names: 4-Fluoro-7-hydroxy-2,3-dihydro-1H-inden-1-one 95%, 4-Fluoro-7-hydroxy-2,3-dihydro-1H-inden-1-one, 95%, 95%, 4-Fluoro-7-hydroxy-2,3-dihydro-1H-inden-1-one, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-fluoro-7-hydroxy-2,3-dihydroinden-1-one (CAS 136191-16-7) is a chemical compound with the molecular formula C9H7FO2 and a molecular weight of 166.15 g/mol. IUPAC name: 4-fluoro-7-hydroxy-2,3-dihydroinden-1-one. InChIKey: SCUZCYGMCGKOPP-UHFFFAOYSA-N.
| Molecular formula | C9H7FO2 |
|---|---|
| Molecular weight | 166.15 g/mol |
| IUPAC name | 4-fluoro-7-hydroxy-2,3-dihydroinden-1-one |
| InChIKey | SCUZCYGMCGKOPP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C=CC(=C21)F)O |
Computed by PubChem (NCBI)