CAS 1361929-42-1 is the registry number for Phytol-d5. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(E,7R,11R)-4,4-dideuterio-7,11,15-trimethyl-3-(trideuteriomethyl)hexadec-2-en-1-ol (CAS 1361929-42-1) is a chemical compound with the molecular formula C20H40O and a molecular weight of 301.6 g/mol. IUPAC name: (E,7R,11R)-4,4-dideuterio-7,11,15-trimethyl-3-(trideuteriomethyl)hexadec-2-en-1-ol. InChIKey: BOTWFXYSPFMFNR-LLZIEIFUSA-N.
| Molecular formula | C20H40O |
|---|---|
| Molecular weight | 301.6 g/mol |
| IUPAC name | (E,7R,11R)-4,4-dideuterio-7,11,15-trimethyl-3-(trideuteriomethyl)hexadec-2-en-1-ol |
| InChIKey | BOTWFXYSPFMFNR-LLZIEIFUSA-N |
| SMILES | [2H]C([2H])([2H])/C(=C\CO)/C([2H])([2H])CC[C@H](C)CCC[C@H](C)CCCC(C)C |
Computed by PubChem (NCBI)