Products 1361941-18-5
CAS 1361941-18-5 appears in our catalog under these names: 2-Cyclopropyl-4,5-dihydro-6h-thieno[2,3-c]pyrrol-6-one, 95%, 2-Cyclopropyl-4,5-dihydro-6h-thieno(2,3-c)pyrrol-6-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
2-cyclopropyl-4,5-dihydrothieno[2,3-c]pyrrol-6-one (CAS 1361941-18-5) is a chemical compound with the molecular formula C9H9NOS and a molecular weight of 179.24 g/mol. IUPAC name: 2-cyclopropyl-4,5-dihydrothieno[2,3-c]pyrrol-6-one. InChIKey: AQSZSJAIHGGXER-UHFFFAOYSA-N.
| Molecular formula | C9H9NOS |
|---|---|
| Molecular weight | 179.24 g/mol |
| IUPAC name | 2-cyclopropyl-4,5-dihydrothieno[2,3-c]pyrrol-6-one |
| InChIKey | AQSZSJAIHGGXER-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC3=C(S2)C(=O)NC3 |
Computed by PubChem (NCBI)