Products 1361950-31-3

CAS 1361950-31-3 is the registry number for 4-Phenylphenyl 3-methylphenyl sulfide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1-methyl-3-(4-phenylphenyl)sulfanylbenzene (CAS 1361950-31-3) is a chemical compound with the molecular formula C19H16S and a molecular weight of 276.4 g/mol. IUPAC name: 1-methyl-3-(4-phenylphenyl)sulfanylbenzene. InChIKey: OJPRAXBHPSDGDC-UHFFFAOYSA-N.

Identity
Molecular formulaC19H16S
Molecular weight276.4 g/mol
IUPAC name1-methyl-3-(4-phenylphenyl)sulfanylbenzene
InChIKeyOJPRAXBHPSDGDC-UHFFFAOYSA-N
SMILESCC1=CC(=CC=C1)SC2=CC=C(C=C2)C3=CC=CC=C3

Computed by PubChem (NCBI)