Products 1361950-33-5

CAS 1361950-33-5 is the registry number for 4-Methylthiophenyl 3-methylphenyl sulfide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1-methyl-3-(4-methylsulfanylphenyl)sulfanylbenzene (CAS 1361950-33-5) is a chemical compound with the molecular formula C14H14S2 and a molecular weight of 246.4 g/mol. IUPAC name: 1-methyl-3-(4-methylsulfanylphenyl)sulfanylbenzene. InChIKey: JRNVLFFFCMJGMH-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14S2
Molecular weight246.4 g/mol
IUPAC name1-methyl-3-(4-methylsulfanylphenyl)sulfanylbenzene
InChIKeyJRNVLFFFCMJGMH-UHFFFAOYSA-N
SMILESCC1=CC(=CC=C1)SC2=CC=C(C=C2)SC

Computed by PubChem (NCBI)