Products 136266-33-6

CAS 136266-33-6 is the registry number for Cinatrin A. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

8-dec-9-enyl-3,4-dihydroxy-2,6-dioxo-1,7-dioxaspiro[4.4]nonane-4-carboxylic acid (CAS 136266-33-6) is a chemical compound with the molecular formula C18H26O8 and a molecular weight of 370.4 g/mol. IUPAC name: 8-dec-9-enyl-3,4-dihydroxy-2,6-dioxo-1,7-dioxaspiro[4.4]nonane-4-carboxylic acid. InChIKey: ZFUPZDZSERSKNA-UHFFFAOYSA-N.

Identity
Molecular formulaC18H26O8
Molecular weight370.4 g/mol
IUPAC name8-dec-9-enyl-3,4-dihydroxy-2,6-dioxo-1,7-dioxaspiro[4.4]nonane-4-carboxylic acid
InChIKeyZFUPZDZSERSKNA-UHFFFAOYSA-N
SMILESC=CCCCCCCCCC1CC2(C(=O)O1)C(C(C(=O)O2)O)(C(=O)O)O

Computed by PubChem (NCBI)