CAS 136310-64-0 appears in our catalog under these names: Tiotropium Bromide Impurity 24, Tiotropium Bromide EP Impurity B, Tiotropium EP Impurity B, Scopine Di(2-thienylglycolate), >95% (HPLC), Scopine-2,2-dithienyl glycolate. Offered by: Chemat Brand, Mikromol, TRC, Biosynth, Ambeed. Available pack sizes: on request, 25mg, 100mg, 10mg, 1g, 50mg, 250mg, 1mg.
[(1R,2R,4S,5S)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate (CAS 136310-64-0) is a chemical compound with the molecular formula C18H19NO4S2 and a molecular weight of 377.5 g/mol. IUPAC name: [(1R,2R,4S,5S)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate. InChIKey: VPJFFOQGKSJBAY-UGTXJPTRSA-N.
| Molecular formula | C18H19NO4S2 |
|---|---|
| Molecular weight | 377.5 g/mol |
| IUPAC name | [(1R,2R,4S,5S)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
| InChIKey | VPJFFOQGKSJBAY-UGTXJPTRSA-N |
| SMILES | CN1[C@@H]2CC(C[C@H]1[C@H]3[C@@H]2O3)OC(=O)C(C4=CC=CS4)(C5=CC=CS5)O |
Computed by PubChem (NCBI)