CAS 1363339-68-7 is the registry number for Oseltamivir Acid Potassium Salt. Offered by: TRC. Available pack sizes: 10mg.
Potassium (3R,4R,5S)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylate (CAS 1363339-68-7) is a chemical compound with the molecular formula C14H23KN2O4 and a molecular weight of 322.44 g/mol. IUPAC name: potassium (3R,4R,5S)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylate. InChIKey: MGDJOHGESXQWMU-LUHWTZLKSA-M.
| Molecular formula | C14H23KN2O4 |
|---|---|
| Molecular weight | 322.44 g/mol |
| IUPAC name | potassium (3R,4R,5S)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylate |
| InChIKey | MGDJOHGESXQWMU-LUHWTZLKSA-M |
| SMILES | CCC(CC)O[C@@H]1C=C(C[C@@H]([C@H]1NC(=O)C)N)C(=O)[O-].[K+] |
Computed by PubChem (NCBI)