Products 1363380-91-9
CAS 1363380-91-9 appears in our catalog under these names: 2–Amino–5–fluoro–4–methoxybenzoic acid, 2-Amino-5-fluoro-4-methoxybenzoic acid, 2-Amino-5-fluoro-4-methoxybenzoic acid 95%, 2-Amino-5-fluoro-4-methoxybenzoic acid, 95%, 95%, 2-AMINO-5-FLUORO-4-METHOXYBENZOIC ACID, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 10g, 1g, 250mg, 5g.
2-amino-5-fluoro-4-methoxybenzoic acid (CAS 1363380-91-9) is a chemical compound with the molecular formula C8H8FNO3 and a molecular weight of 185.15 g/mol. IUPAC name: 2-amino-5-fluoro-4-methoxybenzoic acid. InChIKey: NKAKHMMHWPAUDK-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO3 |
|---|---|
| Molecular weight | 185.15 g/mol |
| IUPAC name | 2-amino-5-fluoro-4-methoxybenzoic acid |
| InChIKey | NKAKHMMHWPAUDK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)N)C(=O)O)F |
Computed by PubChem (NCBI)