CAS 1363381-34-3 is the registry number for 5-Amino-6-iodo-2-pyrazinecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-amino-6-iodopyrazine-2-carboxylic acid (CAS 1363381-34-3) is a chemical compound with the molecular formula C5H4IN3O2 and a molecular weight of 265.01 g/mol. IUPAC name: 5-amino-6-iodopyrazine-2-carboxylic acid. InChIKey: OWZJMNMTLFBLQL-UHFFFAOYSA-N.
| Molecular formula | C5H4IN3O2 |
|---|---|
| Molecular weight | 265.01 g/mol |
| IUPAC name | 5-amino-6-iodopyrazine-2-carboxylic acid |
| InChIKey | OWZJMNMTLFBLQL-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C(=N1)N)I)C(=O)O |
Computed by PubChem (NCBI)