CAS 1363382-18-6 is the registry number for Methyl [2-(3,5-bis(trifluoromethyl)phenyl)-1-methyl-2-oxo-ethyl]carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 100g, 25g, 1g, 250mg.
Methyl N-[1-[3,5-bis(trifluoromethyl)phenyl]-1-oxopropan-2-yl]carbamate (CAS 1363382-18-6) is a chemical compound with the molecular formula C13H11F6NO3 and a molecular weight of 343.22 g/mol. IUPAC name: methyl N-[1-[3,5-bis(trifluoromethyl)phenyl]-1-oxopropan-2-yl]carbamate. InChIKey: QSTKSWLSLJXMJZ-UHFFFAOYSA-N.
| Molecular formula | C13H11F6NO3 |
|---|---|
| Molecular weight | 343.22 g/mol |
| IUPAC name | methyl N-[1-[3,5-bis(trifluoromethyl)phenyl]-1-oxopropan-2-yl]carbamate |
| InChIKey | QSTKSWLSLJXMJZ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)NC(=O)OC |
Computed by PubChem (NCBI)