CAS 13634-93-0 is the registry number for 4-Chloro-Tetrafluorothiophenol. Offered by: Biosynth. Available pack sizes: 50g, 5g.
4-chloro-2,3,5,6-tetrafluorobenzenethiol (CAS 13634-93-0) is a chemical compound with the molecular formula C6HClF4S and a molecular weight of 216.58 g/mol. IUPAC name: 4-chloro-2,3,5,6-tetrafluorobenzenethiol. InChIKey: UXQKSGKKWOHQPO-UHFFFAOYSA-N.
| Molecular formula | C6HClF4S |
|---|---|
| Molecular weight | 216.58 g/mol |
| IUPAC name | 4-chloro-2,3,5,6-tetrafluorobenzenethiol |
| InChIKey | UXQKSGKKWOHQPO-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1S)F)F)Cl)F)F |
Computed by PubChem (NCBI)