CAS 1363405-88-2 is the registry number for tert-Butyl 3-(2-aminopropan-2-yl)pyrrolidine-1-carboxylate, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl 3-(2-aminopropan-2-yl)pyrrolidine-1-carboxylate (CAS 1363405-88-2) is a chemical compound with the molecular formula C12H24N2O2 and a molecular weight of 228.33 g/mol. IUPAC name: tert-butyl 3-(2-aminopropan-2-yl)pyrrolidine-1-carboxylate. InChIKey: GVSQXCLLMNNVSX-UHFFFAOYSA-N.
| Molecular formula | C12H24N2O2 |
|---|---|
| Molecular weight | 228.33 g/mol |
| IUPAC name | tert-butyl 3-(2-aminopropan-2-yl)pyrrolidine-1-carboxylate |
| InChIKey | GVSQXCLLMNNVSX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)C(C)(C)N |
Computed by PubChem (NCBI)