CAS 136382-06-4 is the registry number for 4-(3,4-dichlorophenyl)-1,3-thiazole-2-ylamine, hydrobromide. Offered by: Biosynth. Available pack sizes: 250mg.
4-(3,4-dichlorophenyl)-1,3-thiazol-2-amine;hydrobromide (CAS 136382-06-4) is a chemical compound with the molecular formula C9H7BrCl2N2S and a molecular weight of 326.04 g/mol. IUPAC name: 4-(3,4-dichlorophenyl)-1,3-thiazol-2-amine;hydrobromide. InChIKey: KPPOELIZRLLPGI-UHFFFAOYSA-N.
| Molecular formula | C9H7BrCl2N2S |
|---|---|
| Molecular weight | 326.04 g/mol |
| IUPAC name | 4-(3,4-dichlorophenyl)-1,3-thiazol-2-amine;hydrobromide |
| InChIKey | KPPOELIZRLLPGI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CSC(=N2)N)Cl)Cl.Br |
Computed by PubChem (NCBI)