CAS 136384-19-5 is the registry number for 5-((2,4-Dichlorobenzyl)thio)-1,3,4-thiadiazole-2-thiol, 97%. Offered by: AmBeed. Available pack sizes: 1g.
5-[(2,4-dichlorophenyl)methylsulfanyl]-3H-1,3,4-thiadiazole-2-thione (CAS 136384-19-5) is a chemical compound with the molecular formula C9H6Cl2N2S3 and a molecular weight of 309.3 g/mol. IUPAC name: 5-[(2,4-dichlorophenyl)methylsulfanyl]-3H-1,3,4-thiadiazole-2-thione. InChIKey: XPKHYWRIWANKDK-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2S3 |
|---|---|
| Molecular weight | 309.3 g/mol |
| IUPAC name | 5-[(2,4-dichlorophenyl)methylsulfanyl]-3H-1,3,4-thiadiazole-2-thione |
| InChIKey | XPKHYWRIWANKDK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)CSC2=NNC(=S)S2 |
Computed by PubChem (NCBI)