CAS 1363862-73-0 is the registry number for 1-Methyl-4-(3,3,3-trifluoropropylsulfonyl)benzene, 97%. Offered by: Fluorochem. Available pack sizes: 1g.
1-methyl-4-(3,3,3-trifluoropropylsulfonyl)benzene (CAS 1363862-73-0) is a chemical compound with the molecular formula C10H11F3O2S and a molecular weight of 252.26 g/mol. IUPAC name: 1-methyl-4-(3,3,3-trifluoropropylsulfonyl)benzene. InChIKey: GCCABBQZQMTAGM-UHFFFAOYSA-N.
| Molecular formula | C10H11F3O2S |
|---|---|
| Molecular weight | 252.26 g/mol |
| IUPAC name | 1-methyl-4-(3,3,3-trifluoropropylsulfonyl)benzene |
| InChIKey | GCCABBQZQMTAGM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)CCC(F)(F)F |
Computed by PubChem (NCBI)