CAS 136402-17-0 is the registry number for COASY modulator-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-chloro-2-[(4-chloro-3-nitrophenyl)sulfonylamino]-N-(4-chlorophenyl)benzamide (CAS 136402-17-0) is a chemical compound with the molecular formula C19H12Cl3N3O5S and a molecular weight of 500.7 g/mol. IUPAC name: 5-chloro-2-[(4-chloro-3-nitrophenyl)sulfonylamino]-N-(4-chlorophenyl)benzamide. InChIKey: BFXLAXBXCXOWNH-UHFFFAOYSA-N.
| Molecular formula | C19H12Cl3N3O5S |
|---|---|
| Molecular weight | 500.7 g/mol |
| IUPAC name | 5-chloro-2-[(4-chloro-3-nitrophenyl)sulfonylamino]-N-(4-chlorophenyl)benzamide |
| InChIKey | BFXLAXBXCXOWNH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)C2=C(C=CC(=C2)Cl)NS(=O)(=O)C3=CC(=C(C=C3)Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)