Products 1364078-11-4
CAS 1364078-11-4 is the registry number for Ethyl beta-Alanine-2,2,3,3-d4 Ester. Offered by: TRC. Available pack sizes: 100mg.
Ethyl 3-amino-2,2,3,3-tetradeuteriopropanoate (CAS 1364078-11-4) is a chemical compound with the molecular formula C5H11NO2 and a molecular weight of 121.17 g/mol. IUPAC name: ethyl 3-amino-2,2,3,3-tetradeuteriopropanoate. InChIKey: GSQBIOQCECCMOQ-KHORGVISSA-N.
| Molecular formula | C5H11NO2 |
|---|---|
| Molecular weight | 121.17 g/mol |
| IUPAC name | ethyl 3-amino-2,2,3,3-tetradeuteriopropanoate |
| InChIKey | GSQBIOQCECCMOQ-KHORGVISSA-N |
| SMILES | [2H]C([2H])(C(=O)OCC)C([2H])([2H])N |
Computed by PubChem (NCBI)
Synonyms:
Ethyl ?-Alanine-2,2,3,3-d4 Ester