CAS 13651-07-5 is the registry number for 2,2-Dibromo-1-(3-nitrophenyl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dibromo-1-(3-nitrophenyl)ethanone (CAS 13651-07-5) is a chemical compound with the molecular formula C8H5Br2NO3 and a molecular weight of 322.94 g/mol. IUPAC name: 2,2-dibromo-1-(3-nitrophenyl)ethanone. InChIKey: DPEJIZUJOLUGJI-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2NO3 |
|---|---|
| Molecular weight | 322.94 g/mol |
| IUPAC name | 2,2-dibromo-1-(3-nitrophenyl)ethanone |
| InChIKey | DPEJIZUJOLUGJI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)C(Br)Br |
Computed by PubChem (NCBI)