CAS 1365271-32-4 is the registry number for 5-Bromo-3,4-difluoro-2-(isopropylamino)aniline, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
5-bromo-3,4-difluoro-2-N-propan-2-ylbenzene-1,2-diamine (CAS 1365271-32-4) is a chemical compound with the molecular formula C9H11BrF2N2 and a molecular weight of 265.10 g/mol. IUPAC name: 5-bromo-3,4-difluoro-2-N-propan-2-ylbenzene-1,2-diamine. InChIKey: BEOOLEKKWFESTO-UHFFFAOYSA-N.
| Molecular formula | C9H11BrF2N2 |
|---|---|
| Molecular weight | 265.10 g/mol |
| IUPAC name | 5-bromo-3,4-difluoro-2-N-propan-2-ylbenzene-1,2-diamine |
| InChIKey | BEOOLEKKWFESTO-UHFFFAOYSA-N |
| SMILES | CC(C)NC1=C(C(=C(C=C1N)Br)F)F |
Computed by PubChem (NCBI)