CAS 1365420-08-1 is the registry number for O-(Ethoxymethylphosphinyl)-L-tyrosin. Offered by: TRC. Available pack sizes: 250mg.
(2S)-2-amino-3-[4-[ethoxy(methyl)phosphoryl]oxyphenyl]propanoic acid (CAS 1365420-08-1) is a chemical compound with the molecular formula C12H18NO5P and a molecular weight of 287.25 g/mol. IUPAC name: (2S)-2-amino-3-[4-[ethoxy(methyl)phosphoryl]oxyphenyl]propanoic acid. InChIKey: NANQCSKLSQVZTQ-IFGYVTRGSA-N.
| Molecular formula | C12H18NO5P |
|---|---|
| Molecular weight | 287.25 g/mol |
| IUPAC name | (2S)-2-amino-3-[4-[ethoxy(methyl)phosphoryl]oxyphenyl]propanoic acid |
| InChIKey | NANQCSKLSQVZTQ-IFGYVTRGSA-N |
| SMILES | CCOP(=O)(C)OC1=CC=C(C=C1)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)