Products 1365477-44-6
CAS 1365477-44-6 is the registry number for 2-Fluoropyrrolo[2,1-f][1,2,4]triazin-4-amine, 97.00%, 97.00%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-fluoropyrrolo[2,1-f][1,2,4]triazin-4-amine (CAS 1365477-44-6) is a chemical compound with the molecular formula C6H5FN4 and a molecular weight of 152.13 g/mol. IUPAC name: 2-fluoropyrrolo[2,1-f][1,2,4]triazin-4-amine. InChIKey: KGBHBKOYCNZMKN-UHFFFAOYSA-N.
| Molecular formula | C6H5FN4 |
|---|---|
| Molecular weight | 152.13 g/mol |
| IUPAC name | 2-fluoropyrrolo[2,1-f][1,2,4]triazin-4-amine |
| InChIKey | KGBHBKOYCNZMKN-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C1)C(=NC(=N2)F)N |
Computed by PubChem (NCBI)