Products 13656-41-2
CAS 13656-41-2 appears in our catalog under these names: 2,6-Difluorobenzoyl Fluoride, >98.0%(GC), Benzoyl fluoride, 2,6-difluoro- (8CI,9CI), 98.0%, 98.0%. Offered by: TCI, Chemat. Available pack sizes: 1g, 10g.
2,6-difluorobenzoyl fluoride (CAS 13656-41-2) is a chemical compound with the molecular formula C7H3F3O and a molecular weight of 160.09 g/mol. IUPAC name: 2,6-difluorobenzoyl fluoride. InChIKey: VCOZBIRNAKCGEP-UHFFFAOYSA-N.
| Molecular formula | C7H3F3O |
|---|---|
| Molecular weight | 160.09 g/mol |
| IUPAC name | 2,6-difluorobenzoyl fluoride |
| InChIKey | VCOZBIRNAKCGEP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)F)F |
Computed by PubChem (NCBI)