CAS 1365630-37-0 is the registry number for 4-(4-Chlorophenyl)-2-methyl-5-(trifluoromethyl)-2,3-dihydro-1H-pyrazol-3-imine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(4-chlorophenyl)-1-methyl-3-(trifluoromethyl)pyrazol-5-amine (CAS 1365630-37-0) is a chemical compound with the molecular formula C11H9ClF3N3 and a molecular weight of 275.66 g/mol. IUPAC name: 4-(4-chlorophenyl)-1-methyl-3-(trifluoromethyl)pyrazol-5-amine. InChIKey: VQCZHBCAFWLDKX-UHFFFAOYSA-N.
| Molecular formula | C11H9ClF3N3 |
|---|---|
| Molecular weight | 275.66 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-1-methyl-3-(trifluoromethyl)pyrazol-5-amine |
| InChIKey | VQCZHBCAFWLDKX-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=N1)C(F)(F)F)C2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)