CAS 1365655-90-8 appears in our catalog under these names: Chloroacetamido-peg4-t-butyl ester, 95%, Chloroacetamido–PEG4–C2–Boc, Chloroacetamido-PEG4-t-butyl ester, Chloroacetamido-PEG4-C2-Boc 97%, tert-Butyl 1-Chloro-2-oxo-6,9,12,15-tetraoxa-3-azaoctadecan-18-oate, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 1000mg, 500mg, 250 mg, 100 mg.
Tert-butyl 3-[2-[2-[2-[2-[(2-chloroacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1365655-90-8) is a chemical compound with the molecular formula C17H32ClNO7 and a molecular weight of 397.9 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-[(2-chloroacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: VCADUZGDEHVWCF-UHFFFAOYSA-N.
| Molecular formula | C17H32ClNO7 |
|---|---|
| Molecular weight | 397.9 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-[(2-chloroacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | VCADUZGDEHVWCF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCNC(=O)CCl |
Computed by PubChem (NCBI)