Products 1365803-22-0
CAS 1365803-22-0 is the registry number for tert-Butyl (3-nitro-5-(trifluoromethyl)phenyl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[3-nitro-5-(trifluoromethyl)phenyl]carbamate (CAS 1365803-22-0) is a chemical compound with the molecular formula C12H13F3N2O4 and a molecular weight of 306.24 g/mol. IUPAC name: tert-butyl N-[3-nitro-5-(trifluoromethyl)phenyl]carbamate. InChIKey: YEHWQUJAYMJGIC-UHFFFAOYSA-N.
| Molecular formula | C12H13F3N2O4 |
|---|---|
| Molecular weight | 306.24 g/mol |
| IUPAC name | tert-butyl N-[3-nitro-5-(trifluoromethyl)phenyl]carbamate |
| InChIKey | YEHWQUJAYMJGIC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=CC(=C1)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)