CAS 1365888-06-7 appears in our catalog under these names: Brilanestrant, Brilanestrant/ 98.71% (existing batch purity), Brilanestrant (ARN–810), GDC 0810, Brilanestrant 98+%. Offered by: Chemat Brand, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: on request, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg.
(E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-(1H-indazol-5-yl)but-1-enyl]phenyl]prop-2-enoic acid (CAS 1365888-06-7) is a chemical compound with the molecular formula C26H20ClFN2O2 and a molecular weight of 446.9 g/mol. IUPAC name: (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-(1H-indazol-5-yl)but-1-enyl]phenyl]prop-2-enoic acid. InChIKey: BURHGPHDEVGCEZ-KJGLQBJMSA-N.
| Molecular formula | C26H20ClFN2O2 |
|---|---|
| Molecular weight | 446.9 g/mol |
| IUPAC name | (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-(1H-indazol-5-yl)but-1-enyl]phenyl]prop-2-enoic acid |
| InChIKey | BURHGPHDEVGCEZ-KJGLQBJMSA-N |
| SMILES | CC/C(=C(/C1=CC=C(C=C1)/C=C/C(=O)O)\C2=CC3=C(C=C2)NN=C3)/C4=C(C=C(C=C4)F)Cl |
Computed by PubChem (NCBI)