Products 1365969-48-7

CAS 1365969-48-7 is the registry number for 2-Isopropyl-2h-1,2,3-triazol-4-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-propan-2-yltriazol-4-amine;hydrochloride (CAS 1365969-48-7) is a chemical compound with the molecular formula C5H11ClN4 and a molecular weight of 162.62 g/mol. IUPAC name: 2-propan-2-yltriazol-4-amine;hydrochloride. InChIKey: ZASAQCGMMSCAFI-UHFFFAOYSA-N.

Identity
Molecular formulaC5H11ClN4
Molecular weight162.62 g/mol
IUPAC name2-propan-2-yltriazol-4-amine;hydrochloride
InChIKeyZASAQCGMMSCAFI-UHFFFAOYSA-N
SMILESCC(C)N1N=CC(=N1)N.Cl

Computed by PubChem (NCBI)