CAS 1365988-79-9 is the registry number for 5-(Dimethoxymethyl)-2-fluoro-n'-hydroxybenzenecarboximidamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-(dimethoxymethyl)-2-fluoro-N'-hydroxybenzenecarboximidamide (CAS 1365988-79-9) is a chemical compound with the molecular formula C10H13FN2O3 and a molecular weight of 228.22 g/mol. IUPAC name: 5-(dimethoxymethyl)-2-fluoro-N'-hydroxybenzenecarboximidamide. InChIKey: UNSHVWMXZMITIT-UHFFFAOYSA-N.
| Molecular formula | C10H13FN2O3 |
|---|---|
| Molecular weight | 228.22 g/mol |
| IUPAC name | 5-(dimethoxymethyl)-2-fluoro-N'-hydroxybenzenecarboximidamide |
| InChIKey | UNSHVWMXZMITIT-UHFFFAOYSA-N |
| SMILES | COC(C1=CC(=C(C=C1)F)/C(=N/O)/N)OC |
Computed by PubChem (NCBI)