Products 1366085-75-7

CAS 1366085-75-7 is the registry number for Bendamustine Impurity 65. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 4-(1-methyl-5-morpholin-4-ylbenzimidazol-2-yl)butanoate (CAS 1366085-75-7) is a chemical compound with the molecular formula C18H25N3O3 and a molecular weight of 331.4 g/mol. IUPAC name: ethyl 4-(1-methyl-5-morpholin-4-ylbenzimidazol-2-yl)butanoate. InChIKey: WCCZECQJGWCKDG-UHFFFAOYSA-N.

Identity
Molecular formulaC18H25N3O3
Molecular weight331.4 g/mol
IUPAC nameethyl 4-(1-methyl-5-morpholin-4-ylbenzimidazol-2-yl)butanoate
InChIKeyWCCZECQJGWCKDG-UHFFFAOYSA-N
SMILESCCOC(=O)CCCC1=NC2=C(N1C)C=CC(=C2)N3CCOCC3

Computed by PubChem (NCBI)