CAS 136609-26-2 appears in our catalog under these names: RP 70676, 99+%, RP70676, >95% (HPLC), RP 70676/ 98.89% (existing batch purity), RP 70676, 2-{[5-(3,5-dimethyl-1H-pyrazol-1-yl)pentyl]sulfanyl}-4,5-diphenyl-1H-imidazole. Offered by: AmBeed, TRC, TargetMol, GLPBio, Chemat. Available pack sizes: 1g, 100mg, 10mg, 50mg, 1mg, 5mg, 25mg, 10mM (in 1ml dmso).
1-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-3,5-dimethylpyrazole (CAS 136609-26-2) is a chemical compound with the molecular formula C25H28N4S and a molecular weight of 416.6 g/mol. IUPAC name: 1-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-3,5-dimethylpyrazole. InChIKey: UUPITLNVYVCTFW-UHFFFAOYSA-N.
| Molecular formula | C25H28N4S |
|---|---|
| Molecular weight | 416.6 g/mol |
| IUPAC name | 1-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-3,5-dimethylpyrazole |
| InChIKey | UUPITLNVYVCTFW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1CCCCCSC2=NC(=C(N2)C3=CC=CC=C3)C4=CC=CC=C4)C |
Computed by PubChem (NCBI)