CAS 1366131-27-2 is the registry number for 3–bromo–6–chloro–N–(4–methoxybenzyl)quinolin–2–amine. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
3-bromo-6-chloro-N-[(4-methoxyphenyl)methyl]quinolin-2-amine (CAS 1366131-27-2) is a chemical compound with the molecular formula C17H14BrClN2O and a molecular weight of 377.7 g/mol. IUPAC name: 3-bromo-6-chloro-N-[(4-methoxyphenyl)methyl]quinolin-2-amine. InChIKey: AOPNIFWKRDOEPJ-UHFFFAOYSA-N.
| Molecular formula | C17H14BrClN2O |
|---|---|
| Molecular weight | 377.7 g/mol |
| IUPAC name | 3-bromo-6-chloro-N-[(4-methoxyphenyl)methyl]quinolin-2-amine |
| InChIKey | AOPNIFWKRDOEPJ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CNC2=C(C=C3C=C(C=CC3=N2)Cl)Br |
Computed by PubChem (NCBI)