CAS 1366396-40-8 is the registry number for Cyanomethyl diphenylcarbamodithioate. Offered by: GLPBio. Available pack sizes: 5g.
Cyanomethyl N,N-diphenylcarbamodithioate (CAS 1366396-40-8) is a chemical compound with the molecular formula C15H12N2S2 and a molecular weight of 284.4 g/mol. IUPAC name: cyanomethyl N,N-diphenylcarbamodithioate. InChIKey: MYKFCCXEAFCDMK-UHFFFAOYSA-N.
| Molecular formula | C15H12N2S2 |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | cyanomethyl N,N-diphenylcarbamodithioate |
| InChIKey | MYKFCCXEAFCDMK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C(=S)SCC#N |
Computed by PubChem (NCBI)