CAS 13665-98-0 appears in our catalog under these names: 2,3,4,5,6-Pentabromoaniline, 2,3,4,5,6-Pentabromoaniline, 97%, 97%, 2,3,4,5,6-Pentabromoaniline, 97%. Offered by: TRC, Chemat, Fluorochem. Available pack sizes: 2,5g, 50mg, 250mg, 1g.
2,3,4,5,6-pentabromoaniline (CAS 13665-98-0) is a chemical compound with the molecular formula C6H2Br5N and a molecular weight of 487.61 g/mol. IUPAC name: 2,3,4,5,6-pentabromoaniline. InChIKey: VPFMJGCHDCVATR-UHFFFAOYSA-N.
| Molecular formula | C6H2Br5N |
|---|---|
| Molecular weight | 487.61 g/mol |
| IUPAC name | 2,3,4,5,6-pentabromoaniline |
| InChIKey | VPFMJGCHDCVATR-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1Br)Br)Br)Br)Br)N |
Computed by PubChem (NCBI)