Products 1366664-53-0
CAS 1366664-53-0 is the registry number for Pyrrolidine, 3-(2,2,2-trifluoroethoxy)-, hydrochloride (1:1), (3R)-, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(3R)-3-(2,2,2-trifluoroethoxy)pyrrolidine;hydrochloride (CAS 1366664-53-0) is a chemical compound with the molecular formula C6H11ClF3NO and a molecular weight of 205.60 g/mol. IUPAC name: (3R)-3-(2,2,2-trifluoroethoxy)pyrrolidine;hydrochloride. InChIKey: PHTRRYMVXCCRMZ-NUBCRITNSA-N.
| Molecular formula | C6H11ClF3NO |
|---|---|
| Molecular weight | 205.60 g/mol |
| IUPAC name | (3R)-3-(2,2,2-trifluoroethoxy)pyrrolidine;hydrochloride |
| InChIKey | PHTRRYMVXCCRMZ-NUBCRITNSA-N |
| SMILES | C1CNC[C@@H]1OCC(F)(F)F.Cl |
Computed by PubChem (NCBI)