Products 1366953-12-9
CAS 1366953-12-9 is the registry number for 1,1-Dimethylethyl 3-(5-fluoro-2-methoxyphenyl)-3-hydroxy-1-pyrrolidinecarboxy..., 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 3-(5-fluoro-2-methoxyphenyl)-3-hydroxypyrrolidine-1-carboxylate (CAS 1366953-12-9) is a chemical compound with the molecular formula C16H22FNO4 and a molecular weight of 311.35 g/mol. IUPAC name: tert-butyl 3-(5-fluoro-2-methoxyphenyl)-3-hydroxypyrrolidine-1-carboxylate. InChIKey: LPNXOXAZNCEXRG-UHFFFAOYSA-N.
| Molecular formula | C16H22FNO4 |
|---|---|
| Molecular weight | 311.35 g/mol |
| IUPAC name | tert-butyl 3-(5-fluoro-2-methoxyphenyl)-3-hydroxypyrrolidine-1-carboxylate |
| InChIKey | LPNXOXAZNCEXRG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)(C2=C(C=CC(=C2)F)OC)O |
Computed by PubChem (NCBI)