CAS 136705-64-1 appears in our catalog under these names: (R,R)-Et-DUPHOS 98% 99%ee, (-)-1,2-BIS((2R,5R)-2,5-DIETHYLPHOSPHOLA, 1,2-BIS((2R,5R)-2,5-DIETHYLPHOSPHOLAN-1-YL)BENZENE, 97%. Offered by: Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 500MG.
(2R,5R)-1-[2-[(2R,5R)-2,5-diethylphospholan-1-yl]phenyl]-2,5-diethylphospholane (CAS 136705-64-1) is a chemical compound with the molecular formula C22H36P2 and a molecular weight of 362.5 g/mol. IUPAC name: (2R,5R)-1-[2-[(2R,5R)-2,5-diethylphospholan-1-yl]phenyl]-2,5-diethylphospholane. InChIKey: GVVCHDNSTMEUCS-UAFMIMERSA-N.
| Molecular formula | C22H36P2 |
|---|---|
| Molecular weight | 362.5 g/mol |
| IUPAC name | (2R,5R)-1-[2-[(2R,5R)-2,5-diethylphospholan-1-yl]phenyl]-2,5-diethylphospholane |
| InChIKey | GVVCHDNSTMEUCS-UAFMIMERSA-N |
| SMILES | CC[C@@H]1CC[C@H](P1C2=CC=CC=C2P3[C@@H](CC[C@H]3CC)CC)CC |
Computed by PubChem (NCBI)