CAS 136708-39-9 is the registry number for 4-Acetamido-2,2,6,6-tetramethyl-1-oxopiperidin-1-ium, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2,2,6,6-tetramethyl-1-oxopiperidin-1-ium-4-yl)acetamide (CAS 136708-39-9) is a chemical compound with the molecular formula C11H21N2O2+ and a molecular weight of 213.30 g/mol. IUPAC name: N-(2,2,6,6-tetramethyl-1-oxopiperidin-1-ium-4-yl)acetamide. InChIKey: RZUULVZZWUBAGM-UHFFFAOYSA-O.
| Molecular formula | C11H21N2O2+ |
|---|---|
| Molecular weight | 213.30 g/mol |
| IUPAC name | N-(2,2,6,6-tetramethyl-1-oxopiperidin-1-ium-4-yl)acetamide |
| InChIKey | RZUULVZZWUBAGM-UHFFFAOYSA-O |
| SMILES | CC(=O)NC1CC([N+](=O)C(C1)(C)C)(C)C |
Computed by PubChem (NCBI)