CAS 13674-83-4 is the registry number for 1-Chloro-2-propanol Phosphorochloridate. Offered by: TRC. Available pack sizes: 1mg, 25mg, 5mg.
1-chloro-2-[chloro(1-chloropropan-2-yloxy)phosphoryl]oxypropane (CAS 13674-83-4) is a chemical compound with the molecular formula C6H12Cl3O3P and a molecular weight of 269.5 g/mol. IUPAC name: 1-chloro-2-[chloro(1-chloropropan-2-yloxy)phosphoryl]oxypropane. InChIKey: ITVAVCZXFIPOFV-UHFFFAOYSA-N.
| Molecular formula | C6H12Cl3O3P |
|---|---|
| Molecular weight | 269.5 g/mol |
| IUPAC name | 1-chloro-2-[chloro(1-chloropropan-2-yloxy)phosphoryl]oxypropane |
| InChIKey | ITVAVCZXFIPOFV-UHFFFAOYSA-N |
| SMILES | CC(CCl)OP(=O)(OC(C)CCl)Cl |
Computed by PubChem (NCBI)