CAS 136743-39-0 appears in our catalog under these names: S-(R*,S*))-3-Amino-2-hydroxy-propanoic-3-d Acid, S–(R*,S*))–3–Amino–2–hydroxy–propanoic–3–d Acid. Offered by: TRC, GLPBio. Available pack sizes: 250mg, 5mg.
(2S,3R)-3-amino-3-deuterio-2-hydroxypropanoic acid (CAS 136743-39-0) is a chemical compound with the molecular formula C3H7NO3 and a molecular weight of 106.10 g/mol. IUPAC name: (2S,3R)-3-amino-3-deuterio-2-hydroxypropanoic acid. InChIKey: BMYNFMYTOJXKLE-PJDMKHIJSA-N.
| Molecular formula | C3H7NO3 |
|---|---|
| Molecular weight | 106.10 g/mol |
| IUPAC name | (2S,3R)-3-amino-3-deuterio-2-hydroxypropanoic acid |
| InChIKey | BMYNFMYTOJXKLE-PJDMKHIJSA-N |
| SMILES | [H][C@@]([2H])([C@@H](C(=O)O)O)N |
Computed by PubChem (NCBI)