Products 1367449-16-8
CAS 1367449-16-8 is the registry number for 3-N-Fmoc-3-(2,4-difluorophenyl)propanoic acid, 95%. Offered by: Ambeed. Available pack sizes: 5mg, 10mg, 25mg, 100mg, 250mg.
3-(2,4-difluorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1367449-16-8) is a chemical compound with the molecular formula C24H19F2NO4 and a molecular weight of 423.4 g/mol. IUPAC name: 3-(2,4-difluorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: UVHHNZNGSXECJN-UHFFFAOYSA-N.
| Molecular formula | C24H19F2NO4 |
|---|---|
| Molecular weight | 423.4 g/mol |
| IUPAC name | 3-(2,4-difluorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | UVHHNZNGSXECJN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC(=O)O)C4=C(C=C(C=C4)F)F |
Computed by PubChem (NCBI)