CAS 136765-28-1 is the registry number for Chlorpromazine-D3 0.1 mg/ml in Methanol. Offered by: LoGiCal. Available pack sizes: 1ml.
3-(2-chlorophenothiazin-10-yl)-N-methyl-N-(trideuteriomethyl)propan-1-amine (CAS 136765-28-1) is a chemical compound with the molecular formula C17H19ClN2S and a molecular weight of 321.9 g/mol. IUPAC name: 3-(2-chlorophenothiazin-10-yl)-N-methyl-N-(trideuteriomethyl)propan-1-amine. InChIKey: ZPEIMTDSQAKGNT-FIBGUPNXSA-N.
| Molecular formula | C17H19ClN2S |
|---|---|
| Molecular weight | 321.9 g/mol |
| IUPAC name | 3-(2-chlorophenothiazin-10-yl)-N-methyl-N-(trideuteriomethyl)propan-1-amine |
| InChIKey | ZPEIMTDSQAKGNT-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N(C)CCCN1C2=CC=CC=C2SC3=C1C=C(C=C3)Cl |
Computed by PubChem (NCBI)